C36H60Br2N8 — CID 166072778
4,13-bis[(4-bromophenyl)methyl]-7,16,21,24-tetramethyl-1,4,7,10,13,16,21,24-octazabicyclo[8.8.8]hexacosane (PubChem CID 166072778) has the molecular formula C36H60Br2N8 and a molecular weight of 764.74 g/mol. Its IUPAC name is 4,13-bis[(4-bromophenyl)methyl]-7,16,21,24-tetramethyl-1,4,7,10,13,16,21,24-octazabicyclo[8.8.8]hexacosane.
| Compound Name | 4,13-bis[(4-bromophenyl)methyl]-7,16,21,24-tetramethyl-1,4,7,10,13,16,21,24-octazabicyclo[8.8.8]hexacosane |
|---|---|
| PubChem CID | 166072778 |
| Molecular Formula | C36H60Br2N8 |
| Molecular Weight | 764.74 g/mol |
| Exact Mass | 762.33 |
| IUPAC Name | 4,13-bis[(4-bromophenyl)methyl]-7,16,21,24-tetramethyl-1,4,7,10,13,16,21,24-octazabicyclo[8.8.8]hexacosane |
| SMILES | CN1CCN(C)CCN2CCN(C)CCN(Cc3ccc(Br)cc3)CCN(CC1)CCN(C)CCN(Cc1ccc(Br)cc1)CC2 |
| InChI | InChI=1S/C36H60Br2N8/c1-39-13-14-40(2)16-22-44-24-18-42(4)20-25-45(31-33-5-9-35(37)10-6-33)29-27-43(21-15-39)23-17-41(3)19-26-46(30-28-44)32-34-7-11-36(38)12-8-34/h5-12H,13-32H2,1-4H3 |
| InChIKey | GSXPDEBLSIYCJC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 25.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.74 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |