C15H25BrClN3 — CID 120847697
1-[4-[(4-bromophenyl)methyl]piperazin-1-yl]-2-methylpropan-2-amine;hydrochloride (PubChem CID 120847697) has the molecular formula C15H25BrClN3 and a molecular weight of 362.74 g/mol. Its IUPAC name is 1-[4-[(4-bromophenyl)methyl]piperazin-1-yl]-2-methylpropan-2-amine;hydrochloride.
| Compound Name | 1-[4-[(4-bromophenyl)methyl]piperazin-1-yl]-2-methylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 120847697 |
| Molecular Formula | C15H25BrClN3 |
| Molecular Weight | 362.74 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 1-[4-[(4-bromophenyl)methyl]piperazin-1-yl]-2-methylpropan-2-amine;hydrochloride |
| SMILES | CC(C)(N)CN1CCN(Cc2ccc(Br)cc2)CC1.Cl |
| InChI | InChI=1S/C15H24BrN3.ClH/c1-15(2,17)12-19-9-7-18(8-10-19)11-13-3-5-14(16)6-4-13;/h3-6H,7-12,17H2,1-2H3;1H |
| InChIKey | LLUJYTTXHMRLRC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.74 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |