C16H19BrNO2+ — CID 3648787
(4-bromophenyl)methyl-[(2,4-dimethoxyphenyl)methyl]azanium (PubChem CID 3648787) has the molecular formula C16H19BrNO2+ and a molecular weight of 337.24 g/mol. Its IUPAC name is (4-bromophenyl)methyl-[(2,4-dimethoxyphenyl)methyl]azanium.
| Compound Name | (4-bromophenyl)methyl-[(2,4-dimethoxyphenyl)methyl]azanium |
|---|---|
| PubChem CID | 3648787 |
| Molecular Formula | C16H19BrNO2+ |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | (4-bromophenyl)methyl-[(2,4-dimethoxyphenyl)methyl]azanium |
| SMILES | COc1ccc(C[NH2+]Cc2ccc(Br)cc2)c(OC)c1 |
| InChI | InChI=1S/C16H18BrNO2/c1-19-15-8-5-13(16(9-15)20-2)11-18-10-12-3-6-14(17)7-4-12/h3-9,18H,10-11H2,1-2H3/p+1 |
| InChIKey | ZQBKESGZBXTSNW-UHFFFAOYSA-O |
| XLogP | 2.73 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |