C17H21FNO2+ — CID 2063765
(2,4-dimethoxyphenyl)methyl-[2-(3-fluorophenyl)ethyl]azanium (PubChem CID 2063765) has the molecular formula C17H21FNO2+ and a molecular weight of 290.36 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)methyl-[2-(3-fluorophenyl)ethyl]azanium.
| Compound Name | (2,4-dimethoxyphenyl)methyl-[2-(3-fluorophenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2063765 |
| Molecular Formula | C17H21FNO2+ |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | (2,4-dimethoxyphenyl)methyl-[2-(3-fluorophenyl)ethyl]azanium |
| SMILES | COc1ccc(C[NH2+]CCc2cccc(F)c2)c(OC)c1 |
| InChI | InChI=1S/C17H20FNO2/c1-20-16-7-6-14(17(11-16)21-2)12-19-9-8-13-4-3-5-15(18)10-13/h3-7,10-11,19H,8-9,12H2,1-2H3/p+1 |
| InChIKey | ZCFZTVFHYVEJJW-UHFFFAOYSA-O |
| XLogP | 2.15 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|