C19H24FN3O2 — CID 111296873
1-[(2,4-dimethoxyphenyl)methyl]-3-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine (PubChem CID 111296873) has the molecular formula C19H24FN3O2 and a molecular weight of 345.42 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-3-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine |
|---|---|
| PubChem CID | 111296873 |
| Molecular Formula | C19H24FN3O2 |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.19 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-3-[(3-fluorophenyl)methyl]-1,2-dimethylguanidine |
| SMILES | C/N=C(\NCc1cccc(F)c1)N(C)Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C19H24FN3O2/c1-21-19(22-12-14-6-5-7-16(20)10-14)23(2)13-15-8-9-17(24-3)11-18(15)25-4/h5-11H,12-13H2,1-4H3,(H,21,22) |
| InChIKey | HKMGDJTYJMZKSH-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|