C21H29IN4O4 — CID 111984246
2-[3-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide (PubChem CID 111984246) has the molecular formula C21H29IN4O4 and a molecular weight of 528.39 g/mol. Its IUPAC name is 2-[3-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide.
| Compound Name | 2-[3-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111984246 |
| Molecular Formula | C21H29IN4O4 |
| Molecular Weight | 528.39 g/mol |
| Exact Mass | 528.12 |
| IUPAC Name | 2-[3-[[[N-[(2,4-dimethoxyphenyl)methyl]-N,N'-dimethylcarbamimidoyl]amino]methyl]phenoxy]acetamide;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(OCC(N)=O)c1)N(C)Cc1ccc(OC)cc1OC.I |
| InChI | InChI=1S/C21H28N4O4.HI/c1-23-21(24-12-15-6-5-7-18(10-15)29-14-20(22)26)25(2)13-16-8-9-17(27-3)11-19(16)28-4;/h5-11H,12-14H2,1-4H3,(H2,22,26)(H,23,24);1H |
| InChIKey | PVPLQLWEOSOHNA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.39 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|