C18H23N2O5+ — CID 2247339
(4,5-dimethoxy-2-nitrophenyl)methyl-[2-(3-methoxyphenyl)ethyl]azanium (PubChem CID 2247339) has the molecular formula C18H23N2O5+ and a molecular weight of 347.39 g/mol. Its IUPAC name is (4,5-dimethoxy-2-nitrophenyl)methyl-[2-(3-methoxyphenyl)ethyl]azanium.
| Compound Name | (4,5-dimethoxy-2-nitrophenyl)methyl-[2-(3-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 2247339 |
| Molecular Formula | C18H23N2O5+ |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | (4,5-dimethoxy-2-nitrophenyl)methyl-[2-(3-methoxyphenyl)ethyl]azanium |
| SMILES | COc1cccc(CC[NH2+]Cc2cc(OC)c(OC)cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H22N2O5/c1-23-15-6-4-5-13(9-15)7-8-19-12-14-10-17(24-2)18(25-3)11-16(14)20(21)22/h4-6,9-11,19H,7-8,12H2,1-3H3/p+1 |
| InChIKey | UTJFMFWYTLMBJS-UHFFFAOYSA-O |
| XLogP | 1.93 |
| TPSA | 87.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|