C20H25BrN2O2 — CID 7346256
N-(4-bromophenyl)-1-[(2,4-dimethoxyphenyl)methyl]piperidin-4-amine (PubChem CID 7346256) has the molecular formula C20H25BrN2O2 and a molecular weight of 405.34 g/mol. Its IUPAC name is N-(4-bromophenyl)-1-[(2,4-dimethoxyphenyl)methyl]piperidin-4-amine.
| Compound Name | N-(4-bromophenyl)-1-[(2,4-dimethoxyphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 7346256 |
| Molecular Formula | C20H25BrN2O2 |
| Molecular Weight | 405.34 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | N-(4-bromophenyl)-1-[(2,4-dimethoxyphenyl)methyl]piperidin-4-amine |
| SMILES | COc1ccc(CN2CCC(Nc3ccc(Br)cc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H25BrN2O2/c1-24-19-8-3-15(20(13-19)25-2)14-23-11-9-18(10-12-23)22-17-6-4-16(21)5-7-17/h3-8,13,18,22H,9-12,14H2,1-2H3 |
| InChIKey | IOVMUCRBAICBOJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |