C20H32N2O2 — CID 23791064
1-[(2,4-dimethoxyphenyl)methyl]-4-(2-methylcyclohexyl)piperazine (PubChem CID 23791064) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1-[(2,4-dimethoxyphenyl)methyl]-4-(2-methylcyclohexyl)piperazine.
| Compound Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-(2-methylcyclohexyl)piperazine |
|---|---|
| PubChem CID | 23791064 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | 1-[(2,4-dimethoxyphenyl)methyl]-4-(2-methylcyclohexyl)piperazine |
| SMILES | COc1ccc(CN2CCN(C3CCCCC3C)CC2)c(OC)c1 |
| InChI | InChI=1S/C20H32N2O2/c1-16-6-4-5-7-19(16)22-12-10-21(11-13-22)15-17-8-9-18(23-2)14-20(17)24-3/h8-9,14,16,19H,4-7,10-13,15H2,1-3H3 |
| InChIKey | BHLLHFGQRXQFBK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |