C20H25NO3 — CID 29024699
(2S)-2-benzyl-4-[(2,4-dimethoxyphenyl)methyl]morpholine (PubChem CID 29024699) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is (2S)-2-benzyl-4-[(2,4-dimethoxyphenyl)methyl]morpholine.
| Compound Name | (2S)-2-benzyl-4-[(2,4-dimethoxyphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 29024699 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | (2S)-2-benzyl-4-[(2,4-dimethoxyphenyl)methyl]morpholine |
| SMILES | COc1ccc(CN2CCO[C@@H](Cc3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C20H25NO3/c1-22-18-9-8-17(20(13-18)23-2)14-21-10-11-24-19(15-21)12-16-6-4-3-5-7-16/h3-9,13,19H,10-12,14-15H2,1-2H3/t19-/m0/s1 |
| InChIKey | KWGNJAIIRPGFQN-IBGZPJMESA-N |
| XLogP | 3.15 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |