C19H24N2O2 — CID 120770144
(3S,4R)-1-[(2,4-dimethoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine (PubChem CID 120770144) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is (3S,4R)-1-[(2,4-dimethoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[(2,4-dimethoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120770144 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3S,4R)-1-[(2,4-dimethoxyphenyl)methyl]-4-phenylpyrrolidin-3-amine |
| SMILES | COc1ccc(CN2C[C@@H](N)[C@H](c3ccccc3)C2)c(OC)c1 |
| InChI | InChI=1S/C19H24N2O2/c1-22-16-9-8-15(19(10-16)23-2)11-21-12-17(18(20)13-21)14-6-4-3-5-7-14/h3-10,17-18H,11-13,20H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | LKCZSNWZRAKZOQ-ZWKOTPCHSA-N |
| XLogP | 2.63 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |