C18H21N3O3 — CID 120761307
(3S,4R)-1-[(2-methoxy-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-amine (PubChem CID 120761307) has the molecular formula C18H21N3O3 and a molecular weight of 327.38 g/mol. Its IUPAC name is (3S,4R)-1-[(2-methoxy-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-amine.
| Compound Name | (3S,4R)-1-[(2-methoxy-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 120761307 |
| Molecular Formula | C18H21N3O3 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | (3S,4R)-1-[(2-methoxy-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-amine |
| SMILES | COc1ccc([N+](=O)[O-])cc1CN1C[C@@H](N)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C18H21N3O3/c1-24-18-8-7-15(21(22)23)9-14(18)10-20-11-16(17(19)12-20)13-5-3-2-4-6-13/h2-9,16-17H,10-12,19H2,1H3/t16-,17+/m0/s1 |
| InChIKey | OZOBQZSKYHGXSR-DLBZAZTESA-N |
| XLogP | 2.53 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|