C20H25N3O3 — CID 120759953
[(3R,4R)-1-[(2-ethoxy-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-yl]methanamine (PubChem CID 120759953) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is [(3R,4R)-1-[(2-ethoxy-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-yl]methanamine.
| Compound Name | [(3R,4R)-1-[(2-ethoxy-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 120759953 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [(3R,4R)-1-[(2-ethoxy-5-nitrophenyl)methyl]-4-phenylpyrrolidin-3-yl]methanamine |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1CN1C[C@@H](CN)[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H25N3O3/c1-2-26-20-9-8-18(23(24)25)10-16(20)12-22-13-17(11-21)19(14-22)15-6-4-3-5-7-15/h3-10,17,19H,2,11-14,21H2,1H3/t17-,19+/m1/s1 |
| InChIKey | KQOQJYMQTHJOSN-MJGOQNOKSA-N |
| XLogP | 3.17 |
| TPSA | 81.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|