C20H24N4O3 — CID 120758311
2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-methyl-N-(4-nitrophenyl)acetamide (PubChem CID 120758311) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-methyl-N-(4-nitrophenyl)acetamide.
| Compound Name | 2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-methyl-N-(4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 120758311 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-methyl-N-(4-nitrophenyl)acetamide |
| SMILES | CN(C(=O)CN1C[C@@H](CN)[C@H](c2ccccc2)C1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H24N4O3/c1-22(17-7-9-18(10-8-17)24(26)27)20(25)14-23-12-16(11-21)19(13-23)15-5-3-2-4-6-15/h2-10,16,19H,11-14,21H2,1H3/t16-,19+/m1/s1 |
| InChIKey | JEYHVILOESHQTR-APWZRJJASA-N |
| XLogP | 2.23 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|