C20H22N4O5 — CID 120759452
2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-(6-nitro-1,3-benzodioxol-5-yl)acetamide (PubChem CID 120759452) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-(6-nitro-1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 120759452 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | 2-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-(6-nitro-1,3-benzodioxol-5-yl)acetamide |
| SMILES | NC[C@@H]1CN(CC(=O)Nc2cc3c(cc2[N+](=O)[O-])OCO3)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C20H22N4O5/c21-8-14-9-23(10-15(14)13-4-2-1-3-5-13)11-20(25)22-16-6-18-19(29-12-28-18)7-17(16)24(26)27/h1-7,14-15H,8-12,21H2,(H,22,25)/t14-,15+/m1/s1 |
| InChIKey | UFSJPHUBUPWTDA-CABCVRRESA-N |
| XLogP | 1.94 |
| TPSA | 119.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|