C21H27ClN4O4 — CID 120758538
3-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide;hydrochloride (PubChem CID 120758538) has the molecular formula C21H27ClN4O4 and a molecular weight of 434.92 g/mol. Its IUPAC name is 3-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide;hydrochloride.
| Compound Name | 3-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120758538 |
| Molecular Formula | C21H27ClN4O4 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 3-[(3R,4R)-3-(aminomethyl)-4-phenylpyrrolidin-1-yl]-N-(2-methoxy-5-nitrophenyl)propanamide;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CCN1C[C@@H](CN)[C@H](c2ccccc2)C1.Cl |
| InChI | InChI=1S/C21H26N4O4.ClH/c1-29-20-8-7-17(25(27)28)11-19(20)23-21(26)9-10-24-13-16(12-22)18(14-24)15-5-3-2-4-6-15;/h2-8,11,16,18H,9-10,12-14,22H2,1H3,(H,23,26);1H/t16-,18+;/m1./s1 |
| InChIKey | KYCTVOYVFXEVRJ-CLRXKPRGSA-N |
| XLogP | 3.03 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|