C17H27ClN4O4 — CID 120774538
3-(4-amino-3,3-dimethylpiperidin-1-yl)-N-(2-methoxy-5-nitrophenyl)propanamide;hydrochloride (PubChem CID 120774538) has the molecular formula C17H27ClN4O4 and a molecular weight of 386.88 g/mol. Its IUPAC name is 3-(4-amino-3,3-dimethylpiperidin-1-yl)-N-(2-methoxy-5-nitrophenyl)propanamide;hydrochloride.
| Compound Name | 3-(4-amino-3,3-dimethylpiperidin-1-yl)-N-(2-methoxy-5-nitrophenyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120774538 |
| Molecular Formula | C17H27ClN4O4 |
| Molecular Weight | 386.88 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 3-(4-amino-3,3-dimethylpiperidin-1-yl)-N-(2-methoxy-5-nitrophenyl)propanamide;hydrochloride |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)CCN1CCC(N)C(C)(C)C1.Cl |
| InChI | InChI=1S/C17H26N4O4.ClH/c1-17(2)11-20(8-6-15(17)18)9-7-16(22)19-13-10-12(21(23)24)4-5-14(13)25-3;/h4-5,10,15H,6-9,11,18H2,1-3H3,(H,19,22);1H |
| InChIKey | UTLSCUOPDXDFDZ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 110.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.88 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|