C22H30ClN3O4 — CID 120781865
1-[[4-methoxy-3-[(4-nitrophenyl)methoxy]phenyl]methyl]-3,3-dimethylpiperidin-4-amine;hydrochloride (PubChem CID 120781865) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is 1-[[4-methoxy-3-[(4-nitrophenyl)methoxy]phenyl]methyl]-3,3-dimethylpiperidin-4-amine;hydrochloride.
| Compound Name | 1-[[4-methoxy-3-[(4-nitrophenyl)methoxy]phenyl]methyl]-3,3-dimethylpiperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120781865 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1-[[4-methoxy-3-[(4-nitrophenyl)methoxy]phenyl]methyl]-3,3-dimethylpiperidin-4-amine;hydrochloride |
| SMILES | COc1ccc(CN2CCC(N)C(C)(C)C2)cc1OCc1ccc([N+](=O)[O-])cc1.Cl |
| InChI | InChI=1S/C22H29N3O4.ClH/c1-22(2)15-24(11-10-21(22)23)13-17-6-9-19(28-3)20(12-17)29-14-16-4-7-18(8-5-16)25(26)27;/h4-9,12,21H,10-11,13-15,23H2,1-3H3;1H |
| InChIKey | DFDMIIWZPXKJOR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|