C27H31N3O5 — CID 4279477
N-(2-methoxy-4-nitrophenyl)-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-4-amine (PubChem CID 4279477) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is N-(2-methoxy-4-nitrophenyl)-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-4-amine.
| Compound Name | N-(2-methoxy-4-nitrophenyl)-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 4279477 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | N-(2-methoxy-4-nitrophenyl)-1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-4-amine |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC1CCN(Cc2ccc(OCc3ccccc3)c(OC)c2)CC1 |
| InChI | InChI=1S/C27H31N3O5/c1-33-26-17-23(30(31)32)9-10-24(26)28-22-12-14-29(15-13-22)18-21-8-11-25(27(16-21)34-2)35-19-20-6-4-3-5-7-20/h3-11,16-17,22,28H,12-15,18-19H2,1-2H3 |
| InChIKey | QFCZXIRMLJBOBN-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 86.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|