C28H34N2O4 — CID 4222218
N-(2,4-dimethoxyphenyl)-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]piperidin-4-amine (PubChem CID 4222218) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]piperidin-4-amine.
| Compound Name | N-(2,4-dimethoxyphenyl)-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 4222218 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]piperidin-4-amine |
| SMILES | COc1ccc(NC2CCN(Cc3ccc(OC)c(OCc4ccccc4)c3)CC2)c(OC)c1 |
| InChI | InChI=1S/C28H34N2O4/c1-31-24-10-11-25(27(18-24)33-3)29-23-13-15-30(16-14-23)19-22-9-12-26(32-2)28(17-22)34-20-21-7-5-4-6-8-21/h4-12,17-18,23,29H,13-16,19-20H2,1-3H3 |
| InChIKey | OCBZEKLSYADLJB-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|