C20H25N3O3S — CID 2981366
N-(2-methoxy-5-nitrophenyl)-1-[(4-methylsulfanylphenyl)methyl]piperidin-4-amine (PubChem CID 2981366) has the molecular formula C20H25N3O3S and a molecular weight of 387.51 g/mol. Its IUPAC name is N-(2-methoxy-5-nitrophenyl)-1-[(4-methylsulfanylphenyl)methyl]piperidin-4-amine.
| Compound Name | N-(2-methoxy-5-nitrophenyl)-1-[(4-methylsulfanylphenyl)methyl]piperidin-4-amine |
|---|---|
| PubChem CID | 2981366 |
| Molecular Formula | C20H25N3O3S |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | N-(2-methoxy-5-nitrophenyl)-1-[(4-methylsulfanylphenyl)methyl]piperidin-4-amine |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC1CCN(Cc2ccc(SC)cc2)CC1 |
| InChI | InChI=1S/C20H25N3O3S/c1-26-20-8-5-17(23(24)25)13-19(20)21-16-9-11-22(12-10-16)14-15-3-6-18(27-2)7-4-15/h3-8,13,16,21H,9-12,14H2,1-2H3 |
| InChIKey | CPERZVCDKXLMRR-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 67.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|