C21H25N5O4S — CID 508895
2-amino-N-[2-[[(3R)-1-[(4-methylsulfanylphenyl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-5-nitrobenzamide (PubChem CID 508895) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-amino-N-[2-[[(3R)-1-[(4-methylsulfanylphenyl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-5-nitrobenzamide.
| Compound Name | 2-amino-N-[2-[[(3R)-1-[(4-methylsulfanylphenyl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-5-nitrobenzamide |
|---|---|
| PubChem CID | 508895 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | 2-amino-N-[2-[[(3R)-1-[(4-methylsulfanylphenyl)methyl]pyrrolidin-3-yl]amino]-2-oxoethyl]-5-nitrobenzamide |
| SMILES | CSc1ccc(CN2CC[C@@H](NC(=O)CNC(=O)c3cc([N+](=O)[O-])ccc3N)C2)cc1 |
| InChI | InChI=1S/C21H25N5O4S/c1-31-17-5-2-14(3-6-17)12-25-9-8-15(13-25)24-20(27)11-23-21(28)18-10-16(26(29)30)4-7-19(18)22/h2-7,10,15H,8-9,11-13,22H2,1H3,(H,23,28)(H,24,27)/t15-/m1/s1 |
| InChIKey | BMTHSTVVQGAYFK-OAHLLOKOSA-N |
| XLogP | 2.02 |
| TPSA | 130.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|