C27H36F3N6O4+ — CID 54351951
[5-[[(3R)-3-[[2-[[2-amino-5-(trifluoromethoxy)benzoyl]amino]acetyl]amino]pyrrolidin-1-yl]methyl]-2-methylphenyl]-carbamoyl-diethylazanium (PubChem CID 54351951) has the molecular formula C27H36F3N6O4+ and a molecular weight of 565.62 g/mol. Its IUPAC name is [5-[[(3R)-3-[[2-[[2-amino-5-(trifluoromethoxy)benzoyl]amino]acetyl]amino]pyrrolidin-1-yl]methyl]-2-methylphenyl]-carbamoyl-diethylazanium.
| Compound Name | [5-[[(3R)-3-[[2-[[2-amino-5-(trifluoromethoxy)benzoyl]amino]acetyl]amino]pyrrolidin-1-yl]methyl]-2-methylphenyl]-carbamoyl-diethylazanium |
|---|---|
| PubChem CID | 54351951 |
| Molecular Formula | C27H36F3N6O4+ |
| Molecular Weight | 565.62 g/mol |
| Exact Mass | 565.27 |
| IUPAC Name | [5-[[(3R)-3-[[2-[[2-amino-5-(trifluoromethoxy)benzoyl]amino]acetyl]amino]pyrrolidin-1-yl]methyl]-2-methylphenyl]-carbamoyl-diethylazanium |
| SMILES | CC[N+](CC)(C(N)=O)c1cc(CN2CC[C@@H](NC(=O)CNC(=O)c3cc(OC(F)(F)F)ccc3N)C2)ccc1C |
| InChI | InChI=1S/C27H35F3N6O4/c1-4-36(5-2,26(32)39)23-12-18(7-6-17(23)3)15-35-11-10-19(16-35)34-24(37)14-33-25(38)21-13-20(8-9-22(21)31)40-27(28,29)30/h6-9,12-13,19H,4-5,10-11,14-16H2,1-3H3,(H5-,31,32,33,34,37,38,39)/p+1/t19-/m1/s1 |
| InChIKey | IAHWDIZNDDBFAB-LJQANCHMSA-O |
| XLogP | 3.02 |
| TPSA | 139.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|