C23H29BrN4O2 — CID 508909
2-amino-5-bromo-N-[2-[[1-[(4-methylphenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]benzamide (PubChem CID 508909) has the molecular formula C23H29BrN4O2 and a molecular weight of 473.42 g/mol. Its IUPAC name is 2-amino-5-bromo-N-[2-[[1-[(4-methylphenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]benzamide.
| Compound Name | 2-amino-5-bromo-N-[2-[[1-[(4-methylphenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 508909 |
| Molecular Formula | C23H29BrN4O2 |
| Molecular Weight | 473.42 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 2-amino-5-bromo-N-[2-[[1-[(4-methylphenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]benzamide |
| SMILES | Cc1ccc(CN2CCC(CNC(=O)CNC(=O)c3cc(Br)ccc3N)CC2)cc1 |
| InChI | InChI=1S/C23H29BrN4O2/c1-16-2-4-18(5-3-16)15-28-10-8-17(9-11-28)13-26-22(29)14-27-23(30)20-12-19(24)6-7-21(20)25/h2-7,12,17H,8-11,13-15,25H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | DBVKRINAMDARFF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.42 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|