C22H26ClF2N5O2 — CID 18426149
2-amino-N-[2-[[1-[(3-amino-4-chlorophenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-4,5-difluorobenzamide (PubChem CID 18426149) has the molecular formula C22H26ClF2N5O2 and a molecular weight of 465.93 g/mol. Its IUPAC name is 2-amino-N-[2-[[1-[(3-amino-4-chlorophenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-4,5-difluorobenzamide.
| Compound Name | 2-amino-N-[2-[[1-[(3-amino-4-chlorophenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-4,5-difluorobenzamide |
|---|---|
| PubChem CID | 18426149 |
| Molecular Formula | C22H26ClF2N5O2 |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | 2-amino-N-[2-[[1-[(3-amino-4-chlorophenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-4,5-difluorobenzamide |
| SMILES | Nc1cc(CN2CCC(CNC(=O)CNC(=O)c3cc(F)c(F)cc3N)CC2)ccc1Cl |
| InChI | InChI=1S/C22H26ClF2N5O2/c23-16-2-1-14(7-20(16)27)12-30-5-3-13(4-6-30)10-28-21(31)11-29-22(32)15-8-17(24)18(25)9-19(15)26/h1-2,7-9,13H,3-6,10-12,26-27H2,(H,28,31)(H,29,32) |
| InChIKey | NTAMTYHNMSDVNR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 113.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|