C24H26F3N5O2 — CID 508878
2-amino-N-[2-[[1-[(4-cyanophenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 508878) has the molecular formula C24H26F3N5O2 and a molecular weight of 473.50 g/mol. Its IUPAC name is 2-amino-N-[2-[[1-[(4-cyanophenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-[[1-[(4-cyanophenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 508878 |
| Molecular Formula | C24H26F3N5O2 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | 2-amino-N-[2-[[1-[(4-cyanophenyl)methyl]piperidin-4-yl]methylamino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | N#Cc1ccc(CN2CCC(CNC(=O)CNC(=O)c3cc(C(F)(F)F)ccc3N)CC2)cc1 |
| InChI | InChI=1S/C24H26F3N5O2/c25-24(26,27)19-5-6-21(29)20(11-19)23(34)31-14-22(33)30-13-17-7-9-32(10-8-17)15-18-3-1-16(12-28)2-4-18/h1-6,11,17H,7-10,13-15,29H2,(H,30,33)(H,31,34) |
| InChIKey | TWEUXHNZSXBQNZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 111.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|