C14H17F3N4O2 — CID 174424388
2-amino-N-[2-(1-aminopyrrolidin-3-yl)-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 174424388) has the molecular formula C14H17F3N4O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is 2-amino-N-[2-(1-aminopyrrolidin-3-yl)-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-(1-aminopyrrolidin-3-yl)-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 174424388 |
| Molecular Formula | C14H17F3N4O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-amino-N-[2-(1-aminopyrrolidin-3-yl)-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(=O)NCC(=O)C1CCN(N)C1 |
| InChI | InChI=1S/C14H17F3N4O2/c15-14(16,17)9-1-2-11(18)10(5-9)13(23)20-6-12(22)8-3-4-21(19)7-8/h1-2,5,8H,3-4,6-7,18-19H2,(H,20,23) |
| InChIKey | OGUVEWYLJPOADF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|