C23H26F3N5O5S — CID 22143301
2-amino-N-[2-oxo-2-[[2-[(4-sulfamoylbenzoyl)amino]cyclohexyl]amino]ethyl]-5-(trifluoromethyl)benzamide (PubChem CID 22143301) has the molecular formula C23H26F3N5O5S and a molecular weight of 541.55 g/mol. Its IUPAC name is 2-amino-N-[2-oxo-2-[[2-[(4-sulfamoylbenzoyl)amino]cyclohexyl]amino]ethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-oxo-2-[[2-[(4-sulfamoylbenzoyl)amino]cyclohexyl]amino]ethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 22143301 |
| Molecular Formula | C23H26F3N5O5S |
| Molecular Weight | 541.55 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | 2-amino-N-[2-oxo-2-[[2-[(4-sulfamoylbenzoyl)amino]cyclohexyl]amino]ethyl]-5-(trifluoromethyl)benzamide |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(=O)NCC(=O)NC1CCCCC1NC(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C23H26F3N5O5S/c24-23(25,26)14-7-10-17(27)16(11-14)22(34)29-12-20(32)30-18-3-1-2-4-19(18)31-21(33)13-5-8-15(9-6-13)37(28,35)36/h5-11,18-19H,1-4,12,27H2,(H,29,34)(H,30,32)(H,31,33)(H2,28,35,36) |
| InChIKey | OVHPQIOWPGMWFS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 173.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.55 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|