C24H28F3N5O2S — CID 87589621
2-amino-N-[2-[[5-amino-2-[(4-methylbenzenecarbothioyl)amino]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 87589621) has the molecular formula C24H28F3N5O2S and a molecular weight of 507.58 g/mol. Its IUPAC name is 2-amino-N-[2-[[5-amino-2-[(4-methylbenzenecarbothioyl)amino]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-[[5-amino-2-[(4-methylbenzenecarbothioyl)amino]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 87589621 |
| Molecular Formula | C24H28F3N5O2S |
| Molecular Weight | 507.58 g/mol |
| Exact Mass | 507.19 |
| IUPAC Name | 2-amino-N-[2-[[5-amino-2-[(4-methylbenzenecarbothioyl)amino]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | Cc1ccc(C(=S)NC2CCC(N)CC2NC(=O)CNC(=O)c2cc(C(F)(F)F)ccc2N)cc1 |
| InChI | InChI=1S/C24H28F3N5O2S/c1-13-2-4-14(5-3-13)23(35)32-19-9-7-16(28)11-20(19)31-21(33)12-30-22(34)17-10-15(24(25,26)27)6-8-18(17)29/h2-6,8,10,16,19-20H,7,9,11-12,28-29H2,1H3,(H,30,34)(H,31,33)(H,32,35) |
| InChIKey | KQEVJJULGVHJOG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 122.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.58 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|