C16H23F3N4O3 — CID 69195960
2-amino-N-[2-[[(2S,3S)-1-amino-3-hydroxyhexan-2-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 69195960) has the molecular formula C16H23F3N4O3 and a molecular weight of 376.38 g/mol. Its IUPAC name is 2-amino-N-[2-[[(2S,3S)-1-amino-3-hydroxyhexan-2-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-[[(2S,3S)-1-amino-3-hydroxyhexan-2-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 69195960 |
| Molecular Formula | C16H23F3N4O3 |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-amino-N-[2-[[(2S,3S)-1-amino-3-hydroxyhexan-2-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CCC[C@H](O)C(CN)NC(=O)CNC(=O)c1cc(C(F)(F)F)ccc1N |
| InChI | InChI=1S/C16H23F3N4O3/c1-2-3-13(24)12(7-20)23-14(25)8-22-15(26)10-6-9(16(17,18)19)4-5-11(10)21/h4-6,12-13,24H,2-3,7-8,20-21H2,1H3,(H,22,26)(H,23,25)/t12?,13-/m0/s1 |
| InChIKey | SGBMWAYZEGZRJY-ABLWVSNPSA-N |
| XLogP | 0.62 |
| TPSA | 130.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|