C26H31F3N6O3S — CID 22143137
2-amino-N-[2-[[2-[(4-methylbenzenecarbothioyl)amino]-5-(methylcarbamoylamino)cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 22143137) has the molecular formula C26H31F3N6O3S and a molecular weight of 564.63 g/mol. Its IUPAC name is 2-amino-N-[2-[[2-[(4-methylbenzenecarbothioyl)amino]-5-(methylcarbamoylamino)cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-[[2-[(4-methylbenzenecarbothioyl)amino]-5-(methylcarbamoylamino)cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 22143137 |
| Molecular Formula | C26H31F3N6O3S |
| Molecular Weight | 564.63 g/mol |
| Exact Mass | 564.21 |
| IUPAC Name | 2-amino-N-[2-[[2-[(4-methylbenzenecarbothioyl)amino]-5-(methylcarbamoylamino)cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CNC(=O)NC1CCC(NC(=S)c2ccc(C)cc2)C(NC(=O)CNC(=O)c2cc(C(F)(F)F)ccc2N)C1 |
| InChI | InChI=1S/C26H31F3N6O3S/c1-14-3-5-15(6-4-14)24(39)35-20-10-8-17(33-25(38)31-2)12-21(20)34-22(36)13-32-23(37)18-11-16(26(27,28)29)7-9-19(18)30/h3-7,9,11,17,20-21H,8,10,12-13,30H2,1-2H3,(H,32,37)(H,34,36)(H,35,39)(H2,31,33,38) |
| InChIKey | YATXTAOUEJKHFP-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 137.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.63 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|