C26H31F3N6O4S — CID 44570713
2-amino-N-[2-[[5-(methylcarbamoylamino)-2-[(4-methylsulfanylbenzoyl)amino]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 44570713) has the molecular formula C26H31F3N6O4S and a molecular weight of 580.63 g/mol. Its IUPAC name is 2-amino-N-[2-[[5-(methylcarbamoylamino)-2-[(4-methylsulfanylbenzoyl)amino]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-[[5-(methylcarbamoylamino)-2-[(4-methylsulfanylbenzoyl)amino]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 44570713 |
| Molecular Formula | C26H31F3N6O4S |
| Molecular Weight | 580.63 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 2-amino-N-[2-[[5-(methylcarbamoylamino)-2-[(4-methylsulfanylbenzoyl)amino]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CNC(=O)NC1CCC(NC(=O)c2ccc(SC)cc2)C(NC(=O)CNC(=O)c2cc(C(F)(F)F)ccc2N)C1 |
| InChI | InChI=1S/C26H31F3N6O4S/c1-31-25(39)33-16-6-10-20(35-23(37)14-3-7-17(40-2)8-4-14)21(12-16)34-22(36)13-32-24(38)18-11-15(26(27,28)29)5-9-19(18)30/h3-5,7-9,11,16,20-21H,6,10,12-13,30H2,1-2H3,(H,32,38)(H,34,36)(H,35,37)(H2,31,33,39) |
| InChIKey | MDZATLTZIQXOBU-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 154.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.63 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|