C14H17F3N2OS — CID 99815703
2-amino-N-[(1S,3S)-3-methylsulfanylcyclopentyl]-5-(trifluoromethyl)benzamide (PubChem CID 99815703) has the molecular formula C14H17F3N2OS and a molecular weight of 318.36 g/mol. Its IUPAC name is 2-amino-N-[(1S,3S)-3-methylsulfanylcyclopentyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[(1S,3S)-3-methylsulfanylcyclopentyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 99815703 |
| Molecular Formula | C14H17F3N2OS |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | 2-amino-N-[(1S,3S)-3-methylsulfanylcyclopentyl]-5-(trifluoromethyl)benzamide |
| SMILES | CS[C@H]1CC[C@H](NC(=O)c2cc(C(F)(F)F)ccc2N)C1 |
| InChI | InChI=1S/C14H17F3N2OS/c1-21-10-4-3-9(7-10)19-13(20)11-6-8(14(15,16)17)2-5-12(11)18/h2,5-6,9-10H,3-4,7,18H2,1H3,(H,19,20)/t9-,10-/m0/s1 |
| InChIKey | YQGAIMNNUVJREK-UWVGGRQHSA-N |
| XLogP | 3.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|