C13H14F3NOS — CID 99616260
2,3,6-trifluoro-N-[(1R,3S)-3-methylsulfanylcyclopentyl]benzamide (PubChem CID 99616260) has the molecular formula C13H14F3NOS and a molecular weight of 289.32 g/mol. Its IUPAC name is 2,3,6-trifluoro-N-[(1R,3S)-3-methylsulfanylcyclopentyl]benzamide.
| Compound Name | 2,3,6-trifluoro-N-[(1R,3S)-3-methylsulfanylcyclopentyl]benzamide |
|---|---|
| PubChem CID | 99616260 |
| Molecular Formula | C13H14F3NOS |
| Molecular Weight | 289.32 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2,3,6-trifluoro-N-[(1R,3S)-3-methylsulfanylcyclopentyl]benzamide |
| SMILES | CS[C@H]1CC[C@@H](NC(=O)c2c(F)ccc(F)c2F)C1 |
| InChI | InChI=1S/C13H14F3NOS/c1-19-8-3-2-7(6-8)17-13(18)11-9(14)4-5-10(15)12(11)16/h4-5,7-8H,2-3,6H2,1H3,(H,17,18)/t7-,8+/m1/s1 |
| InChIKey | XHJHSLWTRCAELC-SFYZADRCSA-N |
| XLogP | 3.12 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.32 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|