About 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide
3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide (PubChem CID 79773246) has the molecular formula C15H20F2N2O
and a molecular weight of 282.33 g/mol. Its IUPAC name is 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide |
| PubChem CID | 79773246 |
| Molecular Formula | C15H20F2N2O |
| Molecular Weight | 282.33 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide |
| SMILES | CC1CC(C)CC(NC(=O)c2c(F)ccc(N)c2F)C1 |
| InChI | InChI=1S/C15H20F2N2O/c1-8-5-9(2)7-10(6-8)19-15(20)13-11(16)3-4-12(18)14(13)17/h3-4,8-10H,5-7,18H2,1-2H3,(H,19,20) |
| InChIKey | FYQDEVXNMSJRCM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide?
The IUPAC name of 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide (CID 79773246) is 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide.
What is the SMILES notation for 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide?
The canonical SMILES for 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide is CC1CC(C)CC(NC(=O)c2c(F)ccc(N)c2F)C1.
What is the InChIKey of 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide?
The InChIKey is FYQDEVXNMSJRCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20F2N2O/c1-8-5-9(2)7-10(6-8)19-15(20)13-11(16)3-4-12(18)14(13)17/h3-4,8-10H,5-7,18H2,1-2H3,(H,19,20).
What are the key properties of 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide?
3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide has a molecular weight of 282.33 g/mol, XLogP of 3.10, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(3,5-dimethylcyclohexyl)-2,6-difluorobenzamide is sourced from PubChem (CID 79773246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).