C14H18F2N2O2 — CID 83027170
3-amino-N-(2,2-dimethyloxan-4-yl)-2,6-difluorobenzamide (PubChem CID 83027170) has the molecular formula C14H18F2N2O2 and a molecular weight of 284.31 g/mol. Its IUPAC name is 3-amino-N-(2,2-dimethyloxan-4-yl)-2,6-difluorobenzamide.
| Compound Name | 3-amino-N-(2,2-dimethyloxan-4-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 83027170 |
| Molecular Formula | C14H18F2N2O2 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 3-amino-N-(2,2-dimethyloxan-4-yl)-2,6-difluorobenzamide |
| SMILES | CC1(C)CC(NC(=O)c2c(F)ccc(N)c2F)CCO1 |
| InChI | InChI=1S/C14H18F2N2O2/c1-14(2)7-8(5-6-20-14)18-13(19)11-9(15)3-4-10(17)12(11)16/h3-4,8H,5-7,17H2,1-2H3,(H,18,19) |
| InChIKey | GMPJLRRCPLWQFW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|