C14H19F2N3O — CID 114502840
3-amino-N-(1,3-dimethylpiperidin-4-yl)-2,6-difluorobenzamide (PubChem CID 114502840) has the molecular formula C14H19F2N3O and a molecular weight of 283.32 g/mol. Its IUPAC name is 3-amino-N-(1,3-dimethylpiperidin-4-yl)-2,6-difluorobenzamide.
| Compound Name | 3-amino-N-(1,3-dimethylpiperidin-4-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 114502840 |
| Molecular Formula | C14H19F2N3O |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | 3-amino-N-(1,3-dimethylpiperidin-4-yl)-2,6-difluorobenzamide |
| SMILES | CC1CN(C)CCC1NC(=O)c1c(F)ccc(N)c1F |
| InChI | InChI=1S/C14H19F2N3O/c1-8-7-19(2)6-5-11(8)18-14(20)12-9(15)3-4-10(17)13(12)16/h3-4,8,11H,5-7,17H2,1-2H3,(H,18,20) |
| InChIKey | BCNZVYHSPZGFNM-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|