C14H20F2N4O — CID 114505992
N-(1,3-dimethylpiperidin-4-yl)-3,5-difluoro-4-hydrazinylbenzamide (PubChem CID 114505992) has the molecular formula C14H20F2N4O and a molecular weight of 298.34 g/mol. Its IUPAC name is N-(1,3-dimethylpiperidin-4-yl)-3,5-difluoro-4-hydrazinylbenzamide.
| Compound Name | N-(1,3-dimethylpiperidin-4-yl)-3,5-difluoro-4-hydrazinylbenzamide |
|---|---|
| PubChem CID | 114505992 |
| Molecular Formula | C14H20F2N4O |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N-(1,3-dimethylpiperidin-4-yl)-3,5-difluoro-4-hydrazinylbenzamide |
| SMILES | CC1CN(C)CCC1NC(=O)c1cc(F)c(NN)c(F)c1 |
| InChI | InChI=1S/C14H20F2N4O/c1-8-7-20(2)4-3-12(8)18-14(21)9-5-10(15)13(19-17)11(16)6-9/h5-6,8,12,19H,3-4,7,17H2,1-2H3,(H,18,21) |
| InChIKey | CYXDZXNNADBBMX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|