C12H15F2N3O2 — CID 82737326
3,5-difluoro-4-hydrazinyl-N-(2-methyloxolan-3-yl)benzamide (PubChem CID 82737326) has the molecular formula C12H15F2N3O2 and a molecular weight of 271.27 g/mol. Its IUPAC name is 3,5-difluoro-4-hydrazinyl-N-(2-methyloxolan-3-yl)benzamide.
| Compound Name | 3,5-difluoro-4-hydrazinyl-N-(2-methyloxolan-3-yl)benzamide |
|---|---|
| PubChem CID | 82737326 |
| Molecular Formula | C12H15F2N3O2 |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3,5-difluoro-4-hydrazinyl-N-(2-methyloxolan-3-yl)benzamide |
| SMILES | CC1OCCC1NC(=O)c1cc(F)c(NN)c(F)c1 |
| InChI | InChI=1S/C12H15F2N3O2/c1-6-10(2-3-19-6)16-12(18)7-4-8(13)11(17-15)9(14)5-7/h4-6,10,17H,2-3,15H2,1H3,(H,16,18) |
| InChIKey | DLEVBCXMEVWTQZ-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|