C13H15BrN2O3S — CID 106547462
2-bromo-N-(3-methylsulfanylcyclopentyl)-3-nitrobenzamide (PubChem CID 106547462) has the molecular formula C13H15BrN2O3S and a molecular weight of 359.25 g/mol. Its IUPAC name is 2-bromo-N-(3-methylsulfanylcyclopentyl)-3-nitrobenzamide.
| Compound Name | 2-bromo-N-(3-methylsulfanylcyclopentyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 106547462 |
| Molecular Formula | C13H15BrN2O3S |
| Molecular Weight | 359.25 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 2-bromo-N-(3-methylsulfanylcyclopentyl)-3-nitrobenzamide |
| SMILES | CSC1CCC(NC(=O)c2cccc([N+](=O)[O-])c2Br)C1 |
| InChI | InChI=1S/C13H15BrN2O3S/c1-20-9-6-5-8(7-9)15-13(17)10-3-2-4-11(12(10)14)16(18)19/h2-4,8-9H,5-7H2,1H3,(H,15,17) |
| InChIKey | APKQOKSAKODIMH-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.25 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|