C23H26F3N3O2 — CID 99815640
2-amino-N-[1-[(2R)-2-phenylbutanoyl]piperidin-4-yl]-5-(trifluoromethyl)benzamide (PubChem CID 99815640) has the molecular formula C23H26F3N3O2 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-amino-N-[1-[(2R)-2-phenylbutanoyl]piperidin-4-yl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[1-[(2R)-2-phenylbutanoyl]piperidin-4-yl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 99815640 |
| Molecular Formula | C23H26F3N3O2 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | 2-amino-N-[1-[(2R)-2-phenylbutanoyl]piperidin-4-yl]-5-(trifluoromethyl)benzamide |
| SMILES | CC[C@@H](C(=O)N1CCC(NC(=O)c2cc(C(F)(F)F)ccc2N)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H26F3N3O2/c1-2-18(15-6-4-3-5-7-15)22(31)29-12-10-17(11-13-29)28-21(30)19-14-16(23(24,25)26)8-9-20(19)27/h3-9,14,17-18H,2,10-13,27H2,1H3,(H,28,30)/t18-/m1/s1 |
| InChIKey | LVQPZRDWBBYOAB-GOSISDBHSA-N |
| XLogP | 4.20 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|