C28H34F3N3O3 — CID 171684982
N-[1-[1-(2-phenylbutanoyl)piperidin-4-yl]piperidin-4-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 171684982) has the molecular formula C28H34F3N3O3 and a molecular weight of 517.59 g/mol. Its IUPAC name is N-[1-[1-(2-phenylbutanoyl)piperidin-4-yl]piperidin-4-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-[1-(2-phenylbutanoyl)piperidin-4-yl]piperidin-4-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 171684982 |
| Molecular Formula | C28H34F3N3O3 |
| Molecular Weight | 517.59 g/mol |
| Exact Mass | 517.26 |
| IUPAC Name | N-[1-[1-(2-phenylbutanoyl)piperidin-4-yl]piperidin-4-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | CCC(C(=O)N1CCC(N2CCC(NC(=O)c3ccc(OC(F)(F)F)cc3)CC2)CC1)c1ccccc1 |
| InChI | InChI=1S/C28H34F3N3O3/c1-2-25(20-6-4-3-5-7-20)27(36)34-18-14-23(15-19-34)33-16-12-22(13-17-33)32-26(35)21-8-10-24(11-9-21)37-28(29,30)31/h3-11,22-23,25H,2,12-19H2,1H3,(H,32,35) |
| InChIKey | LOXGLPOEJVSPRS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.59 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |