C24H29F3N4O2S — CID 68828326
2-amino-N-[2-[[2-[(4-methylsulfanylanilino)methyl]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 68828326) has the molecular formula C24H29F3N4O2S and a molecular weight of 494.58 g/mol. Its IUPAC name is 2-amino-N-[2-[[2-[(4-methylsulfanylanilino)methyl]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-[[2-[(4-methylsulfanylanilino)methyl]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 68828326 |
| Molecular Formula | C24H29F3N4O2S |
| Molecular Weight | 494.58 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2-amino-N-[2-[[2-[(4-methylsulfanylanilino)methyl]cyclohexyl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | CSc1ccc(NCC2CCCCC2NC(=O)CNC(=O)c2cc(C(F)(F)F)ccc2N)cc1 |
| InChI | InChI=1S/C24H29F3N4O2S/c1-34-18-9-7-17(8-10-18)29-13-15-4-2-3-5-21(15)31-22(32)14-30-23(33)19-12-16(24(25,26)27)6-11-20(19)28/h6-12,15,21,29H,2-5,13-14,28H2,1H3,(H,30,33)(H,31,32) |
| InChIKey | UKQGFNNLBOCOCT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.58 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|