C29H28F3N3O2S — CID 87590841
N-[2-oxo-2-[[(1R,2S)-2-[(4-phenylbenzenecarbothioyl)amino]cyclohexyl]amino]ethyl]-3-(trifluoromethyl)benzamide (PubChem CID 87590841) has the molecular formula C29H28F3N3O2S and a molecular weight of 539.62 g/mol. Its IUPAC name is N-[2-oxo-2-[[(1R,2S)-2-[(4-phenylbenzenecarbothioyl)amino]cyclohexyl]amino]ethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-oxo-2-[[(1R,2S)-2-[(4-phenylbenzenecarbothioyl)amino]cyclohexyl]amino]ethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 87590841 |
| Molecular Formula | C29H28F3N3O2S |
| Molecular Weight | 539.62 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N-[2-oxo-2-[[(1R,2S)-2-[(4-phenylbenzenecarbothioyl)amino]cyclohexyl]amino]ethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(C(F)(F)F)c1)N[C@@H]1CCCC[C@@H]1NC(=S)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H28F3N3O2S/c30-29(31,32)23-10-6-9-22(17-23)27(37)33-18-26(36)34-24-11-4-5-12-25(24)35-28(38)21-15-13-20(14-16-21)19-7-2-1-3-8-19/h1-3,6-10,13-17,24-25H,4-5,11-12,18H2,(H,33,37)(H,34,36)(H,35,38)/t24-,25+/m1/s1 |
| InChIKey | BITTUPHSHQEPSK-RPBOFIJWSA-N |
| XLogP | 5.49 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.62 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|