C23H25F3N4O4 — CID 10205932
N-[2-[[(1R,2S)-2-[(4-nitrophenyl)methylamino]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 10205932) has the molecular formula C23H25F3N4O4 and a molecular weight of 478.47 g/mol. Its IUPAC name is N-[2-[[(1R,2S)-2-[(4-nitrophenyl)methylamino]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(1R,2S)-2-[(4-nitrophenyl)methylamino]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 10205932 |
| Molecular Formula | C23H25F3N4O4 |
| Molecular Weight | 478.47 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | N-[2-[[(1R,2S)-2-[(4-nitrophenyl)methylamino]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(C(F)(F)F)c1)N[C@@H]1CCCC[C@@H]1NCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H25F3N4O4/c24-23(25,26)17-5-3-4-16(12-17)22(32)28-14-21(31)29-20-7-2-1-6-19(20)27-13-15-8-10-18(11-9-15)30(33)34/h3-5,8-12,19-20,27H,1-2,6-7,13-14H2,(H,28,32)(H,29,31)/t19-,20+/m0/s1 |
| InChIKey | HRSSGCMMZMKXSF-VQTJNVASSA-N |
| XLogP | 3.56 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|