C22H21F3IN3O3 — CID 142158591
N-[2-[[(1S,2S)-2-[(4-iodobenzoyl)amino]cyclopentyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 142158591) has the molecular formula C22H21F3IN3O3 and a molecular weight of 559.33 g/mol. Its IUPAC name is N-[2-[[(1S,2S)-2-[(4-iodobenzoyl)amino]cyclopentyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[(1S,2S)-2-[(4-iodobenzoyl)amino]cyclopentyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 142158591 |
| Molecular Formula | C22H21F3IN3O3 |
| Molecular Weight | 559.33 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | N-[2-[[(1S,2S)-2-[(4-iodobenzoyl)amino]cyclopentyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | O=C(CNC(=O)c1cccc(C(F)(F)F)c1)N[C@H]1CCC[C@@H]1NC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C22H21F3IN3O3/c23-22(24,25)15-4-1-3-14(11-15)20(31)27-12-19(30)28-17-5-2-6-18(17)29-21(32)13-7-9-16(26)10-8-13/h1,3-4,7-11,17-18H,2,5-6,12H2,(H,27,31)(H,28,30)(H,29,32)/t17-,18-/m0/s1 |
| InChIKey | OZDRIOLUCRUWMO-ROUUACIJSA-N |
| XLogP | 3.51 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|