C13H15ClF3N3O2 — CID 66750350
N-[2-(azetidin-3-ylamino)-2-oxoethyl]-3-(trifluoromethyl)benzamide;hydrochloride (PubChem CID 66750350) has the molecular formula C13H15ClF3N3O2 and a molecular weight of 337.73 g/mol. Its IUPAC name is N-[2-(azetidin-3-ylamino)-2-oxoethyl]-3-(trifluoromethyl)benzamide;hydrochloride.
| Compound Name | N-[2-(azetidin-3-ylamino)-2-oxoethyl]-3-(trifluoromethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 66750350 |
| Molecular Formula | C13H15ClF3N3O2 |
| Molecular Weight | 337.73 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | N-[2-(azetidin-3-ylamino)-2-oxoethyl]-3-(trifluoromethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(CNC(=O)c1cccc(C(F)(F)F)c1)NC1CNC1 |
| InChI | InChI=1S/C13H14F3N3O2.ClH/c14-13(15,16)9-3-1-2-8(4-9)12(21)18-7-11(20)19-10-5-17-6-10;/h1-4,10,17H,5-7H2,(H,18,21)(H,19,20);1H |
| InChIKey | QRHYGCDRFNSWCQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.73 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |