C24H31F3N4O4 — CID 91513534
N-[2-[[1-[4-[methyl(3-oxobutanoyl)amino]cyclohexyl]azetidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide (PubChem CID 91513534) has the molecular formula C24H31F3N4O4 and a molecular weight of 496.53 g/mol. Its IUPAC name is N-[2-[[1-[4-[methyl(3-oxobutanoyl)amino]cyclohexyl]azetidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[2-[[1-[4-[methyl(3-oxobutanoyl)amino]cyclohexyl]azetidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 91513534 |
| Molecular Formula | C24H31F3N4O4 |
| Molecular Weight | 496.53 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | N-[2-[[1-[4-[methyl(3-oxobutanoyl)amino]cyclohexyl]azetidin-3-yl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide |
| SMILES | CC(=O)CC(=O)N(C)C1CCC(N2CC(NC(=O)CNC(=O)c3cccc(C(F)(F)F)c3)C2)CC1 |
| InChI | InChI=1S/C24H31F3N4O4/c1-15(32)10-22(34)30(2)19-6-8-20(9-7-19)31-13-18(14-31)29-21(33)12-28-23(35)16-4-3-5-17(11-16)24(25,26)27/h3-5,11,18-20H,6-10,12-14H2,1-2H3,(H,28,35)(H,29,33) |
| InChIKey | XHKKLMFSSXQLQV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.53 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|