C30H32F3N5O4 — CID 22143127
N-[2-[[2-[(4-aminobenzoyl)amino]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide;benzamide (PubChem CID 22143127) has the molecular formula C30H32F3N5O4 and a molecular weight of 583.61 g/mol. Its IUPAC name is N-[2-[[2-[(4-aminobenzoyl)amino]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide;benzamide.
| Compound Name | N-[2-[[2-[(4-aminobenzoyl)amino]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide;benzamide |
|---|---|
| PubChem CID | 22143127 |
| Molecular Formula | C30H32F3N5O4 |
| Molecular Weight | 583.61 g/mol |
| Exact Mass | 583.24 |
| IUPAC Name | N-[2-[[2-[(4-aminobenzoyl)amino]cyclohexyl]amino]-2-oxoethyl]-3-(trifluoromethyl)benzamide;benzamide |
| SMILES | NC(=O)c1ccccc1.Nc1ccc(C(=O)NC2CCCCC2NC(=O)CNC(=O)c2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C23H25F3N4O3.C7H7NO/c24-23(25,26)16-5-3-4-15(12-16)21(32)28-13-20(31)29-18-6-1-2-7-19(18)30-22(33)14-8-10-17(27)11-9-14;8-7(9)6-4-2-1-3-5-6/h3-5,8-12,18-19H,1-2,6-7,13,27H2,(H,28,32)(H,29,31)(H,30,33);1-5H,(H2,8,9) |
| InChIKey | XIBDWNAQMIDVKN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 156.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.61 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|