C21H20F3N5O3 — CID 18426127
2-amino-N-[2-[[1-(1,3-benzoxazol-5-yl)pyrrolidin-3-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide (PubChem CID 18426127) has the molecular formula C21H20F3N5O3 and a molecular weight of 447.42 g/mol. Its IUPAC name is 2-amino-N-[2-[[1-(1,3-benzoxazol-5-yl)pyrrolidin-3-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 2-amino-N-[2-[[1-(1,3-benzoxazol-5-yl)pyrrolidin-3-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 18426127 |
| Molecular Formula | C21H20F3N5O3 |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 2-amino-N-[2-[[1-(1,3-benzoxazol-5-yl)pyrrolidin-3-yl]amino]-2-oxoethyl]-5-(trifluoromethyl)benzamide |
| SMILES | Nc1ccc(C(F)(F)F)cc1C(=O)NCC(=O)NC1CCN(c2ccc3ocnc3c2)C1 |
| InChI | InChI=1S/C21H20F3N5O3/c22-21(23,24)12-1-3-16(25)15(7-12)20(31)26-9-19(30)28-13-5-6-29(10-13)14-2-4-18-17(8-14)27-11-32-18/h1-4,7-8,11,13H,5-6,9-10,25H2,(H,26,31)(H,28,30) |
| InChIKey | CLKBJGXWDYMXKX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 113.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|